CymitQuimica logo

CAS 1016878-45-7

:

3-Amino-N-2-thiazolylpropanamide

Description:
3-Amino-N-2-thiazolylpropanamide is a chemical compound characterized by its unique structural features, which include an amino group and a thiazole ring. The presence of the thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. This compound typically exhibits properties such as solubility in polar solvents, which is common for amides due to their ability to form hydrogen bonds. The amino group can participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, the thiazole ring may impart specific reactivity and stability characteristics, influencing the compound's interactions in biological systems. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many chemical substances, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need to be evaluated in detail for any practical applications.
Formula:C6H9N3OS
InChI:InChI=1S/C6H9N3OS/c7-2-1-5(10)9-6-8-3-4-11-6/h3-4H,1-2,7H2,(H,8,9,10)
InChI key:InChIKey=PDAGLZQIWYSIEW-UHFFFAOYSA-N
SMILES:N(C(CCN)=O)C1=NC=CS1
Synonyms:
  • Propanamide, 3-amino-N-2-thiazolyl-
  • 3-Amino-N-2-thiazolylpropanamide
  • N~1~-1,3-thiazol-2-yl-beta-alaninamide
  • N~1~-1,3-thiazol-2-yl-beta-alaninamide(SALTDATA: 2HCl 0.8H2O)
  • N-1,3-Thiazol-2-yl-β-alaninamide
  • 3-Amino-N-(thiazol-2-yl)propanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.