CAS 101688-02-2

N,N-Bis(2-chloroethyl)-2-nitronaphtho[2,1-b]furan-7-amine

Description:

N,N-Bis(2-chloroethyl)-2-nitronaphtho[2,1-b]furan-7-amine, with CAS number 101688-02-2, is a synthetic organic compound characterized by its complex structure, which includes a naphtho-furan moiety and two chloroethyl substituents. This compound is typically classified as a nitro-containing amine, which may exhibit significant biological activity, particularly in the context of medicinal chemistry. The presence of the nitro group suggests potential reactivity and the ability to participate in various chemical transformations. Its chloroethyl groups can enhance lipophilicity, potentially influencing its pharmacokinetic properties. The compound may be of interest in research related to antitumor agents or other therapeutic applications, given the structural motifs commonly associated with bioactive compounds. However, due to the presence of chlorine and nitro groups, it may also pose environmental and health risks, necessitating careful handling and assessment of its safety profile. Overall, this compound exemplifies the intricate relationship between chemical structure and biological activity in organic chemistry.

Formula: C₁₆H₁₄Cl₂N₂O₃

InChI: InChI=1S/C16H14Cl2N2O3/c17-5-7-19(8-6-18)12-2-3-13-11(9-12)1-4-15-14(13)10-16(23-15)20(21)22/h1-4,9-10H,5-8H2

InChI key: InChIKey=BEYPOADXXCEGDU-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC=2C=3C(=CC(N(CCCl)CCCl)=CC3)C=CC2O1

Synonyms:

• Naphtho[2,1-b]furan-7-amine, N,N-bis(2-chloroethyl)-2-nitro-
• N,N-Bis(2-chloroethyl)-2-nitronaphtho[2,1-b]furan-7-amine

Naphtho[2,1-b]furan-7-amine, N,N-bis(2-chloroethyl)-2-nitro-

CAS: 101688-02-2

Formula: C₁₆H₁₄Cl₂N₂O₃

Molecular weight: 353.2

Ref: IN-DA00057N