CymitQuimica logo

CAS 1016885-73-6

:

2,3-Dihydro-1H-indole-1-ethanimidamide

Description:
2,3-Dihydro-1H-indole-1-ethanimidamide is a chemical compound characterized by its unique bicyclic structure, which includes an indole moiety. This compound features a dihydroindole framework, indicating the presence of a saturated ring system, and an ethanimidamide functional group, which contributes to its reactivity and potential biological activity. The presence of the amide functional group suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Typically, compounds like this may exhibit properties such as moderate polarity, which can affect their pharmacokinetics and bioavailability. The compound's structure may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise information. Overall, 2,3-Dihydro-1H-indole-1-ethanimidamide represents a class of compounds that may hold significance in research and drug development.
Formula:C10H13N3
InChI:InChI=1S/C10H13N3/c11-10(12)7-13-6-5-8-3-1-2-4-9(8)13/h1-4H,5-7H2,(H3,11,12)
InChI key:InChIKey=DWHZJMYABOCSJR-UHFFFAOYSA-N
SMILES:C(C(=N)N)N1C=2C(CC1)=CC=CC2
Synonyms:
  • 1H-Indole-1-ethanimidamide, 2,3-dihydro-
  • 2,3-Dihydro-1H-indole-1-ethanimidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.