
CAS 101689-06-9
:2-Heptanamine, hydrochloride (1:1), (2R)-
Description:
2-Heptanamine, hydrochloride (1:1), (2R)- is an organic compound characterized by its amine functional group, specifically a primary amine due to the presence of a nitrogen atom bonded to a carbon chain. This compound features a seven-carbon straight-chain alkane (heptane) with an amine group attached to the second carbon, indicating its classification as a secondary amine. The hydrochloride form signifies that the amine is protonated, enhancing its solubility in water and making it more stable for storage and handling. As a chiral molecule, it exists in two enantiomeric forms, with the (2R) designation indicating the specific spatial arrangement of its atoms. This compound may be utilized in various applications, including pharmaceuticals and chemical synthesis, due to its potential biological activity. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and the presence of other substances. Safety data should be consulted for handling and usage, as amines can be hazardous.
Formula:C7H17N·ClH
InChI:InChI=1S/C7H17N.ClH/c1-3-4-5-6-7(2)8;/h7H,3-6,8H2,1-2H3;1H/t7-;/m1./s1
InChI key:InChIKey=JOPQZCZKKFHRNT-OGFXRTJISA-N
SMILES:C(CCCC)[C@@H](C)N.Cl
Synonyms:- 2-Heptanamine, hydrochloride, (R)-
- 2-Heptanamine, hydrochloride, (2R)-
- 2-Heptanamine, hydrochloride (1:1), (2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-(−)-2-Aminoheptane Hydrochloride
CAS:Controlled ProductFormula:C7H17N·ClHColor and Shape:NeatMolecular weight:151.678
