
CAS 1017-07-8
:N,N-Dimethyl-3-phenyl-5-isoxazolemethanamine
Description:
N,N-Dimethyl-3-phenyl-5-isoxazolemethanamine, with the CAS number 1017-07-8, is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its potential biological activity. This compound features a dimethylamino group, enhancing its solubility and reactivity. The presence of a phenyl group provides additional stability and may influence its interaction with biological targets. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry. The isoxazole moiety is known for its role in various biological activities, making this compound of interest in research related to neuropharmacology and other therapeutic areas. Its synthesis and characterization involve standard organic chemistry techniques, and it may exhibit specific reactivity patterns due to the functional groups present. Safety and handling precautions are essential, as with many organic compounds, to mitigate any potential hazards associated with its use in laboratory settings. Overall, N,N-Dimethyl-3-phenyl-5-isoxazolemethanamine represents a class of compounds that could have significant implications in drug discovery and development.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c1-14(2)9-11-8-12(13-15-11)10-6-4-3-5-7-10/h3-8H,9H2,1-2H3
InChI key:InChIKey=WTGOJGJYRSBYQN-UHFFFAOYSA-N
SMILES:C(N(C)C)C1=CC(=NO1)C2=CC=CC=C2
Synonyms:- 5-(Dimethylaminomethyl)-3-phenylisoxazole
- N,N-Dimethyl-3-phenyl-5-isoxazolemethanamine
- 5-Isoxazolemethanamine, N,N-dimethyl-3-phenyl-
- Isoxazole, 5-[(dimethylamino)methyl]-3-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.