CAS 1017-58-9

5,5′-Thiobis[2-furancarboxaldehyde]

Description:

5,5′-Thiobis[2-furancarboxaldehyde], with the CAS number 1017-58-9, is an organic compound characterized by its unique structure featuring two furancarboxaldehyde moieties linked by a sulfur atom. This compound typically appears as a yellow to brown solid and is known for its aromatic properties due to the presence of the furan rings. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water. The compound exhibits reactivity typical of aldehydes, including the ability to undergo condensation reactions and participate in nucleophilic additions. Its thiol ether linkage contributes to its stability and potential applications in organic synthesis, particularly in the development of various chemical intermediates and materials. Additionally, 5,5′-Thiobis[2-furancarboxaldehyde] may exhibit biological activity, making it of interest in medicinal chemistry and materials science. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.

Formula: C₁₀H₆O₄S

InChI: InChI=1S/C10H6O4S/c11-5-7-1-3-9(13-7)15-10-4-2-8(6-12)14-10/h1-6H

InChI key: InChIKey=QOYKXSZOMMAGRQ-UHFFFAOYSA-N

SMILES: S(C=1OC(C=O)=CC1)C=2OC(C=O)=CC2

Synonyms:

• 5,5′-Thiodi-2-furaldehyde
• 5,5′-Thiobis[2-furancarboxaldehyde]
• Bis(5-formyl-2-furyl)sulfide
• 2-Furaldehyde, 5,5′-thiodi-
• 2-Furancarboxaldehyde, 5,5′-thiobis-