
CAS 1017-89-6
:Trichlorodiphenylphosphorane
Description:
Trichlorodiphenylphosphorane, with the CAS number 1017-89-6, is an organophosphorus compound characterized by its unique structure, which features a phosphorus atom bonded to two phenyl groups and three chlorine atoms. This compound is typically a white to light yellow solid at room temperature and is known for its reactivity, particularly in nucleophilic substitution reactions. It serves as a useful reagent in organic synthesis, especially in the preparation of phosphonium salts and in the transformation of various organic substrates. Trichlorodiphenylphosphorane is also notable for its role in the synthesis of phosphine oxides and other phosphorus-containing compounds. Due to the presence of chlorine atoms, it can exhibit toxicity and environmental persistence, necessitating careful handling and disposal. Its applications extend to fields such as medicinal chemistry and materials science, where it can be utilized in the development of new compounds and materials. Overall, trichlorodiphenylphosphorane is a significant compound in the realm of synthetic organic chemistry.
Formula:C12H10Cl3P
InChI:InChI=1S/C12H10Cl3P/c13-16(14,15,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H
InChI key:InChIKey=RQIITWKDTBNDJW-UHFFFAOYSA-N
SMILES:P(Cl)(Cl)(Cl)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Trichlorodiphenylphosphorane
- Diphenyltrichlorophosphorane
- Phosphorane, trichlorodiphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
