CymitQuimica logo

CAS 1017022-18-2

:

1-(2,2,2-Trifluoroethyl)-3-pyrrolidinemethanamine

Description:
1-(2,2,2-Trifluoroethyl)-3-pyrrolidinemethanamine, identified by its CAS number 1017022-18-2, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a trifluoroethyl group. This compound typically exhibits properties associated with both amines and fluorinated hydrocarbons, such as increased lipophilicity and potential biological activity. The presence of the trifluoroethyl group can enhance the compound's stability and influence its interaction with biological systems, making it of interest in medicinal chemistry and drug design. Additionally, the pyrrolidine moiety may contribute to its ability to act as a ligand or modulator in various biochemical pathways. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on its molecular interactions and the presence of functional groups. Overall, 1-(2,2,2-Trifluoroethyl)-3-pyrrolidinemethanamine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its potential uses and effects.
Formula:C7H13F3N2
InChI:InChI=1S/C7H13F3N2/c8-7(9,10)5-12-2-1-6(3-11)4-12/h6H,1-5,11H2
InChI key:InChIKey=AWLXCAAXHNSOHI-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)N1CC(CN)CC1
Synonyms:
  • 3-Pyrrolidinemethanamine, 1-(2,2,2-trifluoroethyl)-
  • (1-(2,2,2-Trifluoroethyl)pyrrolidin-3-yl)methanamine
  • 1-(2,2,2-Trifluoroethyl)-3-pyrrolidinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.