CAS 1017028-07-7
:5-Bromo-2-(4-methyl-1-piperidinyl)benzenamine
Description:
5-Bromo-2-(4-methyl-1-piperidinyl)benzenamine is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a piperidine ring. The presence of the bromine atom introduces both electronegativity and steric effects, influencing the compound's reactivity and solubility. The piperidine moiety, a six-membered saturated nitrogen-containing ring, contributes to the compound's basicity and potential for forming hydrogen bonds, which can enhance its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and the piperidine group, making it a candidate for further study in synthetic and medicinal chemistry applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C12H17BrN2
InChI:InChI=1S/C12H17BrN2/c1-9-4-6-15(7-5-9)12-3-2-10(13)8-11(12)14/h2-3,8-9H,4-7,14H2,1H3
InChI key:InChIKey=QDEMLBHNAALEEV-UHFFFAOYSA-N
SMILES:NC1=C(N2CCC(C)CC2)C=CC(Br)=C1
Synonyms:- Benzenamine, 5-bromo-2-(4-methyl-1-piperidinyl)-
- 5-Bromo-2-(4-methyl-1-piperidinyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.