CAS 101704-19-2
:1-[(Phenylthio)methyl]cyclohexanol
Description:
1-[(Phenylthio)methyl]cyclohexanol, with the CAS number 101704-19-2, is an organic compound characterized by its cyclohexanol backbone substituted with a phenylthio group. This compound features a hydroxyl (-OH) functional group, which contributes to its classification as an alcohol. The presence of the phenylthio moiety introduces unique chemical properties, including potential reactivity in nucleophilic substitution reactions and the ability to participate in various organic transformations. The compound is likely to exhibit moderate polarity due to the hydroxyl group, influencing its solubility in polar solvents. Additionally, the cyclohexane ring structure provides a degree of rigidity, which can affect its conformational behavior and interactions with other molecules. The compound may also possess interesting biological activities, making it a subject of interest in medicinal chemistry. Overall, 1-[(Phenylthio)methyl]cyclohexanol is a versatile compound with potential applications in organic synthesis and pharmaceuticals, although specific reactivity and stability would depend on the conditions of use.
Formula:C13H18OS
InChI:InChI=1S/C13H18OS/c14-13(9-5-2-6-10-13)11-15-12-7-3-1-4-8-12/h1,3-4,7-8,14H,2,5-6,9-11H2
InChI key:InChIKey=CRMGYVRRNGABTN-UHFFFAOYSA-N
SMILES:C(SC1=CC=CC=C1)C2(O)CCCCC2
Synonyms:- Cyclohexanol, 1-[(phenylthio)methyl]-
- NSC 311942
- 1-[(Phenylthio)methyl]cyclohexanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.