CAS 1017047-89-0

Methyl 2-[(2-amino-5-thiazolyl)thio]acetate

Description:

Methyl 2-[(2-amino-5-thiazolyl)thio]acetate is a chemical compound characterized by its thiazole ring and amino group, which contribute to its biological activity. The thiazole moiety is known for its presence in various pharmaceuticals and agrochemicals, often exhibiting antimicrobial and antifungal properties. The compound features an ester functional group, which typically enhances its solubility in organic solvents and may influence its reactivity. The presence of the amino group suggests potential for hydrogen bonding, which can affect its interaction with biological targets. Additionally, the thioether linkage in the structure may play a role in its stability and reactivity. Overall, this compound's unique structural features make it of interest in medicinal chemistry and related fields, where it may serve as a lead compound for further development or as a tool for studying biological processes. As with many thiazole derivatives, it may also exhibit a range of pharmacological activities, warranting further investigation into its potential applications.

Formula: C₆H₈N₂O₂S₂

InChI: InChI=1S/C6H8N2O2S2/c1-10-4(9)3-11-5-2-8-6(7)12-5/h2H,3H2,1H3,(H2,7,8)

InChI key: InChIKey=ASKPTAPTORDCTK-UHFFFAOYSA-N

SMILES: S(CC(OC)=O)C1=CN=C(N)S1

Synonyms:

• Acetic acid, 2-[(2-amino-5-thiazolyl)thio]-, methyl ester
• Methyl 2-[(2-amino-5-thiazolyl)thio]acetate