CAS 101705-37-7

Myzodendrone

Description:

Myzodendrone, with the CAS number 101705-37-7, is a chemical compound that belongs to a class of natural products known for their diverse biological activities. It is primarily derived from certain plant species and exhibits a range of characteristics that make it of interest in both pharmacological and ecological studies. Myzodendrone is known for its potential antimicrobial and antifungal properties, which may be attributed to its unique molecular structure. The compound typically features a complex arrangement of functional groups that contribute to its reactivity and interaction with biological systems. Additionally, it may exhibit moderate solubility in organic solvents, which is common for many natural products. Research into Myzodendrone is ongoing, focusing on its mechanisms of action, potential therapeutic applications, and ecological roles within its native habitat. As with many natural compounds, understanding its characteristics can lead to insights into its utility in drug development and environmental science.

Formula: C₁₆H₂₂O₈

InChI: InChI=1S/C16H22O8/c1-8(18)2-3-9-4-5-10(19)11(6-9)23-16-15(22)14(21)13(20)12(7-17)24-16/h4-6,12-17,19-22H,2-3,7H2,1H3/t12-,13-,14+,15-,16-/m1/s1

InChI key: InChIKey=LMPCSMHAJDXHSV-IBEHDNSVSA-N

SMILES: O([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C2=CC(CCC(C)=O)=CC=C2O

Synonyms:

• 4-[3-(β-D-Glucopyranosyloxy)-4-hydroxyphenyl]-2-butanone
• 2-Butanone, 4-[3-(β-D-glucopyranosyloxy)-4-hydroxyphenyl]-
• Myzodendrone

2-Butanone, 4-[3-(β-D-glucopyranosyloxy)-4-hydroxyphenyl]-

CAS: 101705-37-7

Formula: C₁₆H₂₂O₈

Purity: 96.0%

Molecular weight: 342.3411

Ref: IN-DA01S3A3

Myzodendrone

CAS: 101705-37-7

Myzodendrone is a highly effective as free radical scavenger.

Formula: C₁₆H₂₂O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 342.34

Ref: TM-TN4609

Myzodendrone

CAS: 101705-37-7

Myzodendrone is an organic compound, which is a secondary metabolite sourced from parasitic plants in the family Loranthaceae. These plants are primarily found in temperate and tropical regions, where they parasitize host trees. The mode of action for Myzodendrone involves influencing biochemical pathways in both the host and the parasite, facilitating nutrient acquisition and modulation of growth.

Formula: C₁₆H₂₂O₈

Purity: Min. 95%

Molecular weight: 342.34 g/mol

Ref: 3D-BEA70537