CAS 1017051-98-7

7-Amino-N,N-dimethylheptanamide

Description:

7-Amino-N,N-dimethylheptanamide, with the CAS number 1017051-98-7, is an organic compound characterized by its amide functional group and a heptane backbone. This substance features a primary amine group (-NH2) at the 7th carbon position, along with two methyl groups attached to the nitrogen atom, which contributes to its dimethylamine structure. The presence of the amide group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit moderate polarity, making them soluble in polar solvents while having limited solubility in non-polar solvents. The molecular structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis due to the presence of both amine and amide functionalities. Additionally, the compound's characteristics, such as melting point, boiling point, and stability, would depend on its specific molecular interactions and environmental conditions. Overall, 7-Amino-N,N-dimethylheptanamide represents a versatile chemical entity with potential utility in various chemical and biological contexts.

Formula: C₉H₂₀N₂O

InChI: InChI=1S/C9H20N2O/c1-11(2)9(12)7-5-3-4-6-8-10/h3-8,10H2,1-2H3

InChI key: InChIKey=OHIRNYDFJJJRLU-UHFFFAOYSA-N

SMILES: C(C(N(C)C)=O)CCCCCN

Synonyms:

• 7-Amino-N,N-dimethylheptanamide
• Heptanamide, 7-amino-N,N-dimethyl-