CAS 101708-05-8
:N-(2,3-dimethylphenyl)-5-methyl-1H-pyrazole-3-carboxamide
Description:
N-(2,3-dimethylphenyl)-5-methyl-1H-pyrazole-3-carboxamide, with the CAS number 101708-05-8, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the 2,3-dimethylphenyl substituent indicates that it has a bulky aromatic structure, which may influence its solubility and interaction with biological targets. The methyl groups on both the pyrazole and phenyl rings suggest that it may exhibit lipophilic properties, potentially affecting its pharmacokinetics. This compound may be of interest in medicinal chemistry, particularly for its potential therapeutic applications, although specific biological activities would depend on further studies. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity.
Formula:C13H15N3O
InChI:InChI=1/C13H15N3O/c1-8-5-4-6-11(10(8)3)14-13(17)12-7-9(2)15-16-12/h4-7H,1-3H3,(H,14,17)(H,15,16)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrazole-3-carboxamide, N-(2,3-dimethylphenyl)-5-methyl-
CAS:Formula:C13H15N3OMolecular weight:229.2777
