CymitQuimica logo

CAS 10171-92-3

:

dimethyl-(S)-2-methylglutarate

Description:
Dimethyl-(S)-2-methylglutarate is an organic compound characterized by its ester functional groups, specifically featuring two methyl groups attached to the carboxylate moiety. It is a chiral molecule, with the (S) configuration indicating the specific spatial arrangement of its atoms, which can influence its reactivity and interactions in biological systems. This compound is typically a colorless liquid at room temperature and is soluble in organic solvents, making it useful in various chemical applications, including as a building block in organic synthesis and in the production of pharmaceuticals. Its structure includes a five-carbon backbone with branching, which contributes to its unique chemical properties. Dimethyl-(S)-2-methylglutarate can participate in various chemical reactions, such as esterification and transesterification, and may serve as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H14O4
InChI:InChI=1/C8H14O4/c1-6(8(10)12-3)4-5-7(9)11-2/h6H,4-5H2,1-3H3/t6-/m0/s1
SMILES:C[C@@H](CCC(=O)OC)C(=O)OC
Synonyms:
  • (S)-(+)-2-Methylglutaric acid dimethyl ester
  • dimethyl (2S)-2-methylpentanedioate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.