CAS 101713-87-5
:8-Iodo-4-chromanone
Description:
8-Iodo-4-chromanone is an organic compound characterized by its chromanone structure, which features a fused benzene and a carbonyl-containing heterocyclic ring. The presence of an iodine atom at the 8-position of the chromanone ring significantly influences its chemical reactivity and physical properties. This compound typically exhibits a yellow to brown coloration and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic nature. The iodine substituent can participate in various chemical reactions, including nucleophilic substitution and electrophilic aromatic substitution, making it a valuable intermediate in organic synthesis. Additionally, 8-Iodo-4-chromanone may exhibit biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. Its unique structure and reactivity profile make it an interesting subject for further research in synthetic organic chemistry and medicinal chemistry.
Formula:C9H7IO2
InChI:InChI=1/C9H7IO2/c10-7-3-1-2-6-8(11)4-5-12-9(6)7/h1-3H,4-5H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
