CymitQuimica logo

CAS 1017157-84-4

:

2-(4-Chlorophenyl)-1-indolizinemethanamine

Description:
2-(4-Chlorophenyl)-1-indolizinemethanamine, identified by its CAS number 1017157-84-4, is a chemical compound that features a unique structure combining an indolizine moiety with a chlorophenyl group. This compound is characterized by its potential biological activity, which may include interactions with various biological targets, making it of interest in medicinal chemistry and pharmacology. The presence of the 4-chlorophenyl group suggests that it may exhibit specific electronic and steric properties, potentially influencing its reactivity and binding affinity. Additionally, the indolizine framework is known for its role in various chemical reactions and its presence in numerous natural products and synthetic compounds. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. Overall, 2-(4-Chlorophenyl)-1-indolizinemethanamine represents a class of compounds that may have applications in drug development and research, although specific biological activities and mechanisms would require further investigation.
Formula:C15H13ClN2
InChI:InChI=1S/C15H13ClN2/c16-12-6-4-11(5-7-12)14-10-18-8-2-1-3-15(18)13(14)9-17/h1-8,10H,9,17H2
InChI key:InChIKey=PPSMSQXFXUGANW-UHFFFAOYSA-N
SMILES:C(N)C=1C(=CN2C1C=CC=C2)C3=CC=C(Cl)C=C3
Synonyms:
  • 2-(4-Chlorophenyl)-1-indolizinemethanamine
  • 1-Indolizinemethanamine, 2-(4-chlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.