
CAS 1017176-61-2
:3-(3-Ethylphenoxy)-1-propanamine
Description:
3-(3-Ethylphenoxy)-1-propanamine is an organic compound characterized by its amine functional group and ether linkage. It features a propanamine backbone, which is a three-carbon chain with an amine group (-NH2) attached to one end. The presence of the 3-ethylphenoxy group indicates that there is a phenolic structure with an ethyl substituent at the meta position relative to the ether oxygen. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic amine functionalities. It may participate in hydrogen bonding due to the amine group, influencing its solubility in various solvents. The compound's structure suggests potential applications in pharmaceuticals or as a chemical intermediate, although specific biological activities or industrial uses would depend on further research. Safety data, including toxicity and handling precautions, should be consulted for practical applications. Overall, 3-(3-Ethylphenoxy)-1-propanamine represents a unique molecular structure with potential relevance in organic synthesis and medicinal chemistry.
Formula:C11H17NO
InChI:InChI=1S/C11H17NO/c1-2-10-5-3-6-11(9-10)13-8-4-7-12/h3,5-6,9H,2,4,7-8,12H2,1H3
InChI key:InChIKey=ZRMLKYMMVUDDKB-UHFFFAOYSA-N
SMILES:O(CCCN)C1=CC(CC)=CC=C1
Synonyms:- 3-(3-Ethylphenoxy)-1-propanamine
- 1-Propanamine, 3-(3-ethylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.