CAS 1017183-70-8
:4-Fluoro-α-methylbenzenepropanoyl chloride
Description:
4-Fluoro-α-methylbenzenepropanoyl chloride, also known by its CAS number 1017183-70-8, is an organic compound characterized by the presence of a fluorine atom, a methyl group, and an acyl chloride functional group. This compound features a propanoyl chloride moiety attached to a para-fluorinated α-methylbenzene structure, which contributes to its reactivity and potential applications in organic synthesis. The presence of the acyl chloride functional group indicates that it can participate in nucleophilic acyl substitution reactions, making it useful in the synthesis of various derivatives. Additionally, the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in organic solvents. As with many acyl chlorides, it is likely to be sensitive to moisture and should be handled with care to avoid hydrolysis. Overall, 4-Fluoro-α-methylbenzenepropanoyl chloride is a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals, owing to its unique structural features and reactivity.
Formula:C10H10ClFO
InChI:InChI=1S/C10H10ClFO/c1-7(10(11)13)6-8-2-4-9(12)5-3-8/h2-5,7H,6H2,1H3
InChI key:InChIKey=HJOAOPVBPDCOFZ-UHFFFAOYSA-N
SMILES:C(C(C(Cl)=O)C)C1=CC=C(F)C=C1
Synonyms:- Benzenepropanoyl chloride, 4-fluoro-α-methyl-
- 4-Fluoro-α-methylbenzenepropanoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-(4-Fluorophenyl)-2-methylpropanoyl chloride
CAS:3-(4-Fluorophenyl)-2-methylpropanoyl chloride
Molecular weight:200.6372g/mol


