CymitQuimica logo

CAS 10172-69-7

:

3,3′-[(2-Nitrophenyl)methylene]bis[4-hydroxy-2H-1-benzopyran-2-one]

Description:
3,3′-[(2-Nitrophenyl)methylene]bis[4-hydroxy-2H-1-benzopyran-2-one], commonly referred to as a flavonoid derivative, exhibits several notable characteristics. This compound features a bis-flavonoid structure, which is characterized by two flavonoid units linked by a methylene bridge. The presence of a nitrophenyl group introduces electron-withdrawing properties, which can influence the compound's reactivity and solubility. Typically, such compounds demonstrate antioxidant activity due to the presence of hydroxyl groups, which can donate hydrogen atoms to free radicals. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of anti-inflammatory or anticancer agents. Additionally, the compound may exhibit UV-Vis absorbance properties, making it useful in photochemical studies. Its solubility may vary depending on the solvent, with polar solvents likely enhancing solubility due to the presence of hydroxyl groups. Overall, this compound represents a significant interest in both synthetic and natural product chemistry due to its structural complexity and potential biological activities.
Formula:C25H15NO8
InChI:InChI=1S/C25H15NO8/c27-22-14-8-2-5-11-17(14)33-24(29)20(22)19(13-7-1-4-10-16(13)26(31)32)21-23(28)15-9-3-6-12-18(15)34-25(21)30/h1-12,19,27-28H
InChI key:InChIKey=TUHSRMSCBAFLPJ-UHFFFAOYSA-N
SMILES:C(C1=C(O)C=2C(OC1=O)=CC=CC2)(C3=C(O)C=4C(OC3=O)=CC=CC4)C5=C(N(=O)=O)C=CC=C5
Synonyms:
  • Coumarin, 3,3′-(o-nitrobenzylidene)bis[4-hydroxy-
  • 3,3′-((2-Nitrophenyl)methylene)bis(4-hydroxy-2H-chromen-2-one)
  • 3,3′-[(2-Nitrophenyl)methylene]bis[4-hydroxy-2H-1-benzopyran-2-one]
  • 2H-1-Benzopyran-2-one, 3,3′-[(2-nitrophenyl)methylene]bis[4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.