CAS 1017212-41-7

4-[2-(3-Methyl-1-piperidinyl)ethyl]benzenamine

Description:

4-[2-(3-Methyl-1-piperidinyl)ethyl]benzenamine, also known by its CAS number 1017212-41-7, is an organic compound characterized by its amine functional group and a piperidine ring. This substance features a benzene ring substituted with an ethyl chain that connects to a piperidine moiety, which contains a methyl group at the 3-position. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often found in various pharmaceuticals and bioactive compounds. The compound is likely to exhibit moderate to high solubility in organic solvents due to its hydrophobic aromatic structure, while the amine group may impart some degree of polarity. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds targeting neurological or psychiatric conditions. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. Safety and handling considerations should also be taken into account, as with any chemical substance.

Formula: C₁₄H₂₂N₂

InChI: InChI=1S/C14H22N2/c1-12-3-2-9-16(11-12)10-8-13-4-6-14(15)7-5-13/h4-7,12H,2-3,8-11,15H2,1H3

InChI key: InChIKey=AHJKXDIEAYBVMI-UHFFFAOYSA-N

SMILES: C(CN1CC(C)CCC1)C2=CC=C(N)C=C2

Synonyms:

• Benzenamine, 4-[2-(3-methyl-1-piperidinyl)ethyl]-
• 4-[2-(3-Methyl-1-piperidinyl)ethyl]benzenamine