CAS 1017219-84-9

1,2,3,4-Tetrahydro-6-methoxy-3-(1-methylethyl)quinoline

Description:

1,2,3,4-Tetrahydro-6-methoxy-3-(1-methylethyl)quinoline is a chemical compound characterized by its bicyclic structure, which includes a quinoline moiety. This compound features a tetrahydroquinoline framework, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of a methoxy group (-OCH3) at the 6-position contributes to its chemical reactivity and solubility properties, while the isopropyl group (1-methylethyl) at the 3-position enhances its hydrophobic characteristics. This compound may exhibit biological activity, potentially interacting with various biological targets due to its structural features. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 1017219-84-9, allows for its identification in chemical databases, facilitating research and application in various fields, including organic synthesis and drug discovery. Overall, the unique combination of functional groups and ring structure makes this compound a subject of interest for further study in both chemical and biological contexts.

Formula: C₁₃H₁₉NO

InChI: InChI=1S/C13H19NO/c1-9(2)11-6-10-7-12(15-3)4-5-13(10)14-8-11/h4-5,7,9,11,14H,6,8H2,1-3H3

InChI key: InChIKey=JUPSTCXLRFVYBY-UHFFFAOYSA-N

SMILES: C(C)(C)C1CC=2C(=CC=C(OC)C2)NC1

Synonyms:

• 1,2,3,4-Tetrahydro-6-methoxy-3-(1-methylethyl)quinoline
• Quinoline, 1,2,3,4-tetrahydro-6-methoxy-3-(1-methylethyl)-