
CAS 101724-23-6
:3-Chloro-2-furancarboxaldehyde
Description:
3-Chloro-2-furancarboxaldehyde is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. The presence of a chloro group at the 3-position and an aldehyde functional group at the 2-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. The aldehyde group makes it a reactive species, capable of participating in various chemical reactions, such as nucleophilic additions and condensation reactions. Additionally, the chlorinated furan derivatives are of interest in medicinal chemistry and materials science due to their biological activity and potential use as building blocks in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and respiratory system.
Formula:C5H3ClO2
InChI:InChI=1S/C5H3ClO2/c6-4-1-2-8-5(4)3-7/h1-3H
InChI key:InChIKey=RGKSEDIMASREGO-UHFFFAOYSA-N
SMILES:C(=O)C1=C(Cl)C=CO1
Synonyms:- 3-Chloro-2-furancarboxaldehyde
- 2-Furaldehyde, 3-chloro-
- 3-Chlorofuran-2-carbaldehyde
- 2-Furancarboxaldehyde, 3-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.