CAS 1017250-61-1

5,6-Dihydro-2-(3-piperidinyl)-4H-cyclopentathiazole

Description:

5,6-Dihydro-2-(3-piperidinyl)-4H-cyclopentathiazole is a heterocyclic compound characterized by its unique structure, which includes a cyclopentathiazole ring fused with a piperidine moiety. This compound features a five-membered ring containing sulfur and nitrogen atoms, contributing to its potential biological activity. The presence of the piperidine group enhances its solubility and may influence its pharmacological properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The thiazole and piperidine components may impart specific interactions with biological targets, making it a candidate for further research in drug discovery. Additionally, the compound's stability, reactivity, and interaction with other molecules can be influenced by its electronic structure and steric factors. As with many heterocycles, the synthesis and characterization of this compound are crucial for understanding its properties and potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₁H₁₆N₂S

InChI: InChI=1S/C11H16N2S/c1-4-9-10(5-1)14-11(13-9)8-3-2-6-12-7-8/h8,12H,1-7H2

InChI key: InChIKey=XYWFGZKQFBKBMH-UHFFFAOYSA-N

SMILES: C1(=NC2=C(S1)CCC2)C3CCCNC3

Synonyms:

• 4H-Cyclopentathiazole, 5,6-dihydro-2-(3-piperidinyl)-
• 5,6-Dihydro-2-(3-piperidinyl)-4H-cyclopentathiazole