CAS 10173-53-2

2-(6-methyl-1H-benzimidazol-2-yl)aniline

Description:

2-(6-methyl-1H-benzimidazol-2-yl)aniline, with the CAS number 10173-53-2, is an organic compound characterized by its structure, which includes a benzimidazole moiety and an aniline group. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals, dyes, or as a chemical intermediate. The presence of the methyl group on the benzimidazole ring can influence its solubility and reactivity. It may also exhibit biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in hydrogen bonding due to the amino group, affecting its interactions in various environments. Additionally, its stability and reactivity can be influenced by factors such as pH and temperature. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information, as the specific characteristics can vary based on purity and environmental conditions.

Formula: C₁₄H₁₃N₃

InChI: InChI=1/C14H13N3/c1-9-6-7-12-13(8-9)17-14(16-12)10-4-2-3-5-11(10)15/h2-8H,15H2,1H3,(H,16,17)

SMILES: Cc1ccc2c(c1)[nH]c(c1ccccc1N)n2

2-(5-methyl-1H-1,3-benzodiazol-2-yl)aniline

CAS: 10173-53-2

Formula: C₁₄H₁₃N₃

Molecular weight: 223.2731

Ref: IN-DA0005BW

2-(5-Methyl-1H-1,3-benzodiazol-2-yl)aniline

CAS: 10173-53-2

Versatile small molecule scaffold

Formula: C₁₄H₁₃N₃

Purity: Min. 95%

Molecular weight: 223.27 g/mol

Ref: 3D-KAA17353