CAS 10173-56-5

2-(1H-benzimidazol-2-yl)-4-chloroaniline

Description:

2-(1H-benzimidazol-2-yl)-4-chloroaniline, with the CAS number 10173-56-5, is a chemical compound characterized by its unique structure, which includes a benzimidazole moiety and a chloroaniline group. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the chloro group enhances its reactivity and may influence its solubility and stability in various solvents. The benzimidazole ring contributes to its ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, this compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological effects can vary based on the context of use. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2-(1H-benzimidazol-2-yl)-4-chloroaniline represents a class of compounds that are valuable in research and development within the chemical and pharmaceutical industries.

Formula: C₁₃H₁₀ClN₃

InChI: InChI=1/C13H10ClN3/c14-8-5-6-10(15)9(7-8)13-16-11-3-1-2-4-12(11)17-13/h1-7H,15H2,(H,16,17)

SMILES: c1ccc2c(c1)nc(c1cc(ccc1N)Cl)[nH]2

Synonyms:

• 2-(1H-1,3-benzodiazol-2-yl)-4-chloroaniline
• 2-(1H-benzo[d]imidazol-2-yl)-4-chloroaniline

2-(1H-1,3-Benzodiazol-2-yl)-4-chloroaniline

CAS: 10173-56-5

Versatile small molecule scaffold

Formula: C₁₃H₁₀ClN₃

Purity: Min. 95%

Molecular weight: 243.69 g/mol

Ref: 3D-KAA17356