CymitQuimica logo

CAS 1017388-36-1

:

2,3-Dihydro-2-(2-methoxyethyl)-1H-isoindol-4-amine

Description:
2,3-Dihydro-2-(2-methoxyethyl)-1H-isoindol-4-amine is a chemical compound characterized by its isoindole structure, which features a bicyclic system comprising a benzene ring fused to a five-membered nitrogen-containing ring. This compound contains an amine functional group, which contributes to its potential reactivity and biological activity. The presence of the methoxyethyl substituent enhances its solubility and may influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The molecular structure suggests that it may exhibit properties such as moderate polarity and the ability to form hydrogen bonds, which are crucial for interactions with biological macromolecules. Additionally, the compound's specific stereochemistry and functional groups can significantly affect its biological activity, making it a subject of interest in drug discovery and development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H16N2O
InChI:InChI=1S/C11H16N2O/c1-14-6-5-13-7-9-3-2-4-11(12)10(9)8-13/h2-4H,5-8,12H2,1H3
InChI key:InChIKey=LIOIKDHMWUEJNK-UHFFFAOYSA-N
SMILES:NC1=C2C(CN(CCOC)C2)=CC=C1
Synonyms:
  • 2,3-Dihydro-2-(2-methoxyethyl)-1H-isoindol-4-amine
  • 1H-Isoindol-4-amine, 2,3-dihydro-2-(2-methoxyethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.