CAS 10174-71-7
:8-Bromo-4-hydroxy-2-quinolinecarboxylic acid
Description:
8-Bromo-4-hydroxy-2-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which features a bromine atom and a hydroxyl group at specific positions on the aromatic ring. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and biochemistry, particularly as a building block in the synthesis of various bioactive molecules. The presence of the bromine atom enhances its reactivity, making it useful in substitution reactions. The hydroxyl group contributes to its acidity, allowing it to participate in acid-base reactions. Additionally, the carboxylic acid functional group can engage in hydrogen bonding, influencing its solubility and interaction with biological systems. This compound may exhibit antimicrobial or anti-inflammatory properties, making it of interest in medicinal chemistry. Its unique structural features and functional groups provide a basis for further exploration in drug development and chemical synthesis. As with many chemical substances, safety precautions should be observed when handling it due to potential toxicity.
Formula:C10H6BrNO3
InChI:InChI=1S/C10H6BrNO3/c11-6-3-1-2-5-8(13)4-7(10(14)15)12-9(5)6/h1-4H,(H,12,13)(H,14,15)
InChI key:InChIKey=QVLPEZFQNJXXMZ-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C(O)=CC(C(O)=O)=N2)C=CC1
Synonyms:- 4-Hydroxy-8-bromoquinoline-2-carboxylic acid
- 8-Bromo-4-hydroxy-2-quinolinecarboxylic acid
- 2-Quinolinecarboxylic acid, 8-bromo-4-hydroxy-
- Quinaldic acid, 8-bromo-4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
