CymitQuimica logo

CAS 10174-72-8

:

6-chloro-4-oxo-1,4-dihydroquinoline-2-carboxylic acid

Description:
6-Chloro-4-oxo-1,4-dihydroquinoline-2-carboxylic acid, with the CAS number 10174-72-8, is a heterocyclic organic compound characterized by its quinoline structure, which features a fused aromatic ring system. This compound contains a chloro substituent at the 6-position and a carboxylic acid group at the 2-position, contributing to its acidic properties. The presence of the keto group at the 4-position enhances its reactivity and potential for forming various derivatives. It is typically a crystalline solid, and its solubility can vary depending on the solvent used, often being more soluble in polar solvents due to the carboxylic acid functionality. This compound is of interest in medicinal chemistry and may exhibit biological activity, making it a candidate for further research in drug development. Its structural features suggest potential applications in the synthesis of other complex molecules and in the study of quinoline derivatives, which are known for their diverse pharmacological properties.
Formula:C10H6ClNO3
InChI:InChI=1/C10H6ClNO3/c11-5-1-2-7-6(3-5)9(13)4-8(12-7)10(14)15/h1-4H,(H,12,13)(H,14,15)
SMILES:c1cc2c(cc1Cl)c(=O)cc(C(=O)O)[nH]2
Synonyms:
  • 2-Quinolinecarboxylic Acid, 6-Chloro-4-Hydroxy-
  • 6-Chloro-4-Hydroxyquinoline-2-Carboxylic Acid
  • 6-Chloro-4-hydroxy-quinoline-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.