
CAS 1017403-05-2
:2-Chloro-6-ethoxy-α-methyl-3-quinolinemethanol
Description:
2-Chloro-6-ethoxy-α-methyl-3-quinolinemethanol is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 2-position and an ethoxy group at the 6-position, contributing to its unique reactivity and solubility properties. The presence of the α-methyl group enhances its steric properties, potentially influencing its biological activity. As a quinolinemethanol derivative, it may exhibit various pharmacological effects, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in hydrogen bonding due to the hydroxyl (-OH) group, which may enhance its solubility in polar solvents. Additionally, the chlorine atom may impart specific electronic characteristics, affecting its reactivity and interaction with biological targets. Overall, 2-Chloro-6-ethoxy-α-methyl-3-quinolinemethanol is a complex organic molecule with potential applications in drug development and research.
Formula:C13H14ClNO2
InChI:InChI=1S/C13H14ClNO2/c1-3-17-10-4-5-12-9(6-10)7-11(8(2)16)13(14)15-12/h4-8,16H,3H2,1-2H3
InChI key:InChIKey=MYTKDZZTYQUGKL-UHFFFAOYSA-N
SMILES:C(C)(O)C1=CC2=C(N=C1Cl)C=CC(OCC)=C2
Synonyms:- 3-Quinolinemethanol, 2-chloro-6-ethoxy-α-methyl-
- 2-Chloro-6-ethoxy-α-methyl-3-quinolinemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.