CAS 1017422-91-1
:1-Methyl-α-3-pyridinyl-1H-benzimidazole-2-methanamine
Description:
1-Methyl-α-3-pyridinyl-1H-benzimidazole-2-methanamine, identified by its CAS number 1017422-91-1, is a chemical compound that belongs to the class of benzimidazole derivatives. This substance features a benzimidazole core, which is a bicyclic structure composed of a benzene ring fused to an imidazole ring, with a methyl group and a pyridine moiety attached. The presence of the methyl group at the 1-position and the pyridinyl group at the α-position contributes to its unique chemical properties and potential biological activity. Compounds of this type are often studied for their pharmacological properties, including potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The specific interactions and reactivity of this compound can be influenced by its functional groups, making it a subject of interest in various chemical and biological research fields. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances.
Formula:C14H14N4
InChI:InChI=1S/C14H14N4/c1-18-12-7-3-2-6-11(12)17-14(18)13(15)10-5-4-8-16-9-10/h2-9,13H,15H2,1H3
InChI key:InChIKey=DFJGRSQUVQALCE-UHFFFAOYSA-N
SMILES:C(N)(C=1N(C)C=2C(N1)=CC=CC2)C=3C=CC=NC3
Synonyms:- 1H-Benzimidazole-2-methanamine, 1-methyl-α-3-pyridinyl-
- 1-Methyl-α-3-pyridinyl-1H-benzimidazole-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
