CAS 101743-65-1
:ethyl 6-(1-naphthyl)-6-oxo-hexanoate
Description:
Ethyl 6-(1-naphthyl)-6-oxo-hexanoate, with the CAS number 101743-65-1, is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a hexanoate backbone, indicating a six-carbon chain, with a ketone group (6-oxo) and a naphthyl substituent at the 6-position. The presence of the naphthyl group contributes to its aromatic characteristics, potentially influencing its reactivity and solubility. Ethyl 6-(1-naphthyl)-6-oxo-hexanoate may exhibit properties typical of esters, such as pleasant odors and volatility, making it of interest in various applications, including organic synthesis and potentially in the fragrance industry. Its structure suggests it may participate in reactions typical of both esters and ketones, such as nucleophilic acyl substitution or condensation reactions. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C18H20O3
InChI:InChI=1/C18H20O3/c1-2-21-18(20)13-6-5-12-17(19)16-11-7-9-14-8-3-4-10-15(14)16/h3-4,7-11H,2,5-6,12-13H2,1H3
SMILES:CCOC(=O)CCCCC(=O)c1cccc2ccccc12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
