CAS 1017463-80-7

1-(2-Chloro-7-methoxy-3-quinolinyl)ethanone

Description:

1-(2-Chloro-7-methoxy-3-quinolinyl)ethanone, with the CAS number 1017463-80-7, is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro substituent at the 2-position and a methoxy group at the 7-position of the quinoline ring, contributing to its unique chemical properties. The ethanone functional group indicates the presence of a carbonyl (C=O) adjacent to an ethyl group, which can influence its reactivity and potential applications. The presence of halogen and methoxy groups typically enhances the compound's biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the compound's structural features suggest potential interactions with biological targets, which may lead to various pharmacological effects. As with many quinoline derivatives, it may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would be necessary to confirm these effects.

Formula: C₁₂H₁₀ClNO₂

InChI: InChI=1S/C12H10ClNO2/c1-7(15)10-5-8-3-4-9(16-2)6-11(8)14-12(10)13/h3-6H,1-2H3

InChI key: InChIKey=DOLUEKRYLFUYHD-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC2=C(C=C(OC)C=C2)N=C1Cl

Synonyms:

• 1-(2-Chloro-7-methoxyquinolin-3-yl)ethan-1-one
• Ethanone, 1-(2-chloro-7-methoxy-3-quinolinyl)-
• 1-(2-Chloro-7-methoxy-3-quinolinyl)ethanone