CymitQuimica logo

CAS 1017464-09-3

:

1,2,3,4-Tetrahydro-2,4-dioxo-1-(2,2,2-trifluoroethyl)-5-pyrimidinecarbonitrile

Description:
1,2,3,4-Tetrahydro-2,4-dioxo-1-(2,2,2-trifluoroethyl)-5-pyrimidinecarbonitrile is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine ring and multiple functional groups. The presence of a dioxo group indicates that it has two carbonyl functionalities, contributing to its reactivity and potential applications in medicinal chemistry. The trifluoroethyl substituent enhances lipophilicity and may influence the compound's biological activity, making it of interest in drug design. The carbonitrile group adds to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound is likely to exhibit specific physical properties, including solubility in organic solvents and potential stability under certain conditions. Its unique combination of functional groups suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties, reactivity, and potential uses in various chemical contexts.
Formula:C7H4F3N3O2
InChI:InChI=1S/C7H4F3N3O2/c8-7(9,10)3-13-2-4(1-11)5(14)12-6(13)15/h2H,3H2,(H,12,14,15)
InChI key:InChIKey=CREPNRCGZLTVHD-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)N1C=C(C#N)C(=O)NC1=O
Synonyms:
  • 5-Pyrimidinecarbonitrile, 1,2,3,4-tetrahydro-2,4-dioxo-1-(2,2,2-trifluoroethyl)-
  • 1,2,3,4-Tetrahydro-2,4-dioxo-1-(2,2,2-trifluoroethyl)-5-pyrimidinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.