
CAS 1017481-33-2
:3-[4-(1-Methylethyl)phenyl]morpholine
Description:
3-[4-(1-Methylethyl)phenyl]morpholine, identified by its CAS number 1017481-33-2, is an organic compound characterized by its morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. This compound features a phenyl group substituted with an isopropyl group at the para position, contributing to its hydrophobic characteristics. The presence of the morpholine moiety imparts basic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests that it may exhibit moderate solubility in organic solvents, while its interactions with polar solvents could be limited due to the hydrophobic isopropyl group. Additionally, the compound may possess biological activity, making it of interest in pharmaceutical research. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through empirical studies. Overall, 3-[4-(1-Methylethyl)phenyl]morpholine represents a unique structure that could have diverse applications in organic synthesis and medicinal chemistry.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-10(2)11-3-5-12(6-4-11)13-9-15-8-7-14-13/h3-6,10,13-14H,7-9H2,1-2H3
InChI key:InChIKey=CGAPWOGSDYFKDD-UHFFFAOYSA-N
SMILES:C(C)(C)C1=CC=C(C=C1)C2COCCN2
Synonyms:- 3-[4-(1-Methylethyl)phenyl]morpholine
- Morpholine, 3-[4-(1-methylethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.