CAS 1017553-77-3

2-(2-Methoxy-5-methylphenyl)cyclopropanecarboxylic acid

Description:

2-(2-Methoxy-5-methylphenyl)cyclopropanecarboxylic acid is a chemical compound characterized by its cyclopropane structure, which is a three-membered carbon ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methoxy and methyl substituents on the phenyl ring enhances its lipophilicity and may influence its biological activity. The molecular structure suggests potential for interactions with biological systems, making it of interest in medicinal chemistry. Its unique arrangement of functional groups may also impart specific reactivity patterns, making it suitable for various synthetic applications. Additionally, the compound's stability, solubility, and melting point can vary based on environmental conditions and the presence of other solvents or reagents. Overall, this compound exemplifies the complexity of organic molecules and their potential utility in pharmaceutical development and research.

Formula: C₁₂H₁₄O₃

InChI: InChI=1S/C12H14O3/c1-7-3-4-11(15-2)9(5-7)8-6-10(8)12(13)14/h3-5,8,10H,6H2,1-2H3,(H,13,14)

InChI key: InChIKey=VWYVBEAWKKCHMV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C(C1)C2=C(OC)C=CC(C)=C2

Synonyms:

• 2-(2-Methoxy-5-methylphenyl)cyclopropanecarboxylic acid
• 2-(2-Methoxy-5-methylphenyl)cyclopropane-1-carboxylic acid
• Cyclopropanecarboxylic acid, 2-(2-methoxy-5-methylphenyl)-