CAS 101756-40-5

2-(3-Thienylmethylene)propanedinitrile

Description:

2-(3-Thienylmethylene)propanedinitrile, with the CAS number 101756-40-5, is an organic compound characterized by its unique structure that includes a thienyl group and two nitrile functional groups. The presence of the thienyl moiety, which is derived from thiophene, imparts aromatic properties and potential reactivity due to the electron-rich nature of the sulfur-containing ring. The nitrile groups contribute to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its chemical properties make it of interest in organic synthesis and materials science, particularly in the development of functionalized polymers or as intermediates in the synthesis of more complex molecules. Additionally, the compound's potential applications in pharmaceuticals or agrochemicals may be explored due to the biological activity often associated with thienyl derivatives. Safety data should be consulted for handling and storage, as nitriles can be toxic and hazardous.

Formula: C₈H₄N₂S

InChI: InChI=1S/C8H4N2S/c9-4-8(5-10)3-7-1-2-11-6-7/h1-3,6H

InChI key: InChIKey=ZKWANBRFSVNZTG-UHFFFAOYSA-N

SMILES: C(=C(C#N)C#N)C=1C=CSC1

Synonyms:

• 2-(3-Thienylmethylene)propanedinitrile
• 2-(Thien-3-ylmethylene)malononitrile
• NSC 172839
• Propanedinitrile, (3-thienylmethylene)-
• Propanedinitrile, 2-(3-thienylmethylene)-