CAS 1017603-87-0

Methyl 6-bromo-5-chloro-2-pyrazinecarboxylate

Description:

Methyl 6-bromo-5-chloro-2-pyrazinecarboxylate is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of bromine and chlorine substituents at the 6 and 5 positions, respectively, contributes to its reactivity and potential applications in various chemical reactions. The methyl ester functional group at the carboxylate position enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. Its unique combination of halogen substituents and the pyrazine framework may also impart specific electronic properties, making it a subject of interest in materials science and medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₆H₄BrClN₂O₂

InChI: InChI=1S/C6H4BrClN2O2/c1-12-6(11)3-2-9-5(8)4(7)10-3/h2H,1H3

InChI key: InChIKey=PMNRFTVMUXRTFN-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=NC(Br)=C(Cl)N=C1

Synonyms:

• 2-Pyrazinecarboxylic acid, 6-bromo-5-chloro-, methyl ester
• Methyl 6-bromo-5-chloro-2-pyrazinecarboxylate

Methyl 6-bromo-5-chloropyrazine-2-carboxylate

CAS: 1017603-87-0

Versatile small molecule scaffold

Formula: C₆H₄BrClN₂O₂

Purity: Min. 95%

Molecular weight: 251.46 g/mol

Ref: 3D-SQB60387