CAS 1017608-23-9
:2-Iodo-5-(1-methylethyl)phenol
Description:
2-Iodo-5-(1-methylethyl)phenol is an organic compound characterized by its phenolic structure, which includes an iodine atom and an isopropyl group attached to the aromatic ring. The presence of the iodine substituent at the second position and the isopropyl group at the fifth position of the phenol ring significantly influences its chemical properties, including its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the iodine atom can impart unique reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The compound may also possess biological activity, which could be of interest in pharmaceutical applications. However, specific safety and handling guidelines should be followed, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 2-Iodo-5-(1-methylethyl)phenol represents a versatile structure in organic synthesis and medicinal chemistry.
Formula:C9H11IO
InChI:InChI=1S/C9H11IO/c1-6(2)7-3-4-8(10)9(11)5-7/h3-6,11H,1-2H3
InChI key:InChIKey=FSOJEWSMQWKEMS-UHFFFAOYSA-N
SMILES:C(C)(C)C1=CC(O)=C(I)C=C1
Synonyms:- 2-Iodo-5-(propan-2-yl)phenol
- Phenol, 2-iodo-5-(1-methylethyl)-
- 2-Iodo-5-propan-2-ylphenol
- 2-Iodo-5-isopropylphenol
- 2-Iodo-5-(1-methylethyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.