CAS 1017608-26-2

5-(1,1-Dimethylethyl)-2,4-diiodophenol

Description:

5-(1,1-Dimethylethyl)-2,4-diiodophenol, identified by its CAS number 1017608-26-2, is an organic compound characterized by the presence of a phenolic structure substituted with iodine and a tert-butyl group. This compound features two iodine atoms located at the 2 and 4 positions of the phenol ring, which significantly influences its chemical reactivity and physical properties. The tert-butyl group at the 5 position enhances its lipophilicity, making it more soluble in organic solvents compared to water. The presence of iodine atoms typically imparts a degree of biological activity, and such compounds may exhibit antimicrobial or antioxidant properties. Additionally, the bulky tert-butyl group can affect the steric hindrance around the phenolic hydroxyl group, potentially influencing its reactivity in various chemical reactions. Overall, this compound is of interest in fields such as medicinal chemistry, materials science, and environmental chemistry due to its unique structural features and potential applications.

Formula: C₁₀H₁₂I₂O

InChI: InChI=1S/C10H12I2O/c1-10(2,3)6-4-9(13)8(12)5-7(6)11/h4-5,13H,1-3H3

InChI key: InChIKey=SVUMGUYTRBJEOM-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=C(I)C=C(I)C(O)=C1

Synonyms:

• Phenol, 5-(1,1-dimethylethyl)-2,4-diiodo-
• 5-(1,1-Dimethylethyl)-2,4-diiodophenol