CAS 101769-04-4
:3-(BENZENESULFONYL)PYRROLIDINE
Description:
3-(Benzenesulfonyl)pyrrolidine is an organic compound characterized by the presence of a pyrrolidine ring substituted with a benzenesulfonyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The sulfonyl group enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the pyrrolidine ring contributes to its potential biological activity, as many pyrrolidine derivatives are known for their pharmacological properties. The compound may be utilized in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, its structural features allow for the exploration of its properties in materials science and organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C10H13NO2S
InChI:InChI=1/C10H13NO2S/c12-14(13,10-6-7-11-8-10)9-4-2-1-3-5-9/h1-5,10-11H,6-8H2
SMILES:c1ccc(cc1)S(=O)(=O)C1CCNC1
Synonyms:- 3-(Phenylsulfonyl)Pyrrolidine
- Intrchm-Bb E8155
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
