CAS 10177-11-4
:3-Cyano-5-phenylpyridine
Description:
3-Cyano-5-phenylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a cyano group (-C≡N) at the 3-position and a phenyl group (a benzene ring) at the 5-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its ability to act as a building block in organic synthesis. It exhibits moderate polarity, which influences its solubility in various organic solvents. The cyano group can participate in nucleophilic reactions, while the phenyl group can engage in π-π stacking interactions, enhancing its reactivity and stability. Additionally, 3-Cyano-5-phenylpyridine may exhibit interesting electronic properties due to the conjugation between the cyano and phenyl groups, making it a subject of interest in materials science and medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H8N2
InChI:InChI=1/C12H8N2/c13-7-10-6-12(9-14-8-10)11-4-2-1-3-5-11/h1-6,8-9H
InChI key:InChIKey=CTVJVGOUKSPYST-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1)C2=CC=CC=C2
Synonyms:- 3-Pyridinecarbonitrile, 5-Phenyl-
- 5-Phenyl-3-pyridinecarbonitrile
- 5-Phenylnicotinonitrile
- 5-Phenylpyridine-3-Carbonitrile
- NSC 167779
- Nicotinonitrile, 5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
