CAS 10177-21-6

4-chloro-2-(chloromethyl)pyridine

Description:

4-Chloro-2-(chloromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with chlorine atoms. It features a chlorine atom at the 4-position and a chloromethyl group at the 2-position of the pyridine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity, particularly due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. The compound is used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other organic compounds. Its properties include moderate solubility in organic solvents and potential toxicity, necessitating careful handling and storage. As with many chlorinated compounds, it may pose environmental and health risks, highlighting the importance of proper safety protocols during its use.

Formula: C₆H₅Cl₂N

InChI: InChI=1/C6H5Cl2N/c7-4-6-3-5(8)1-2-9-6/h1-3H,4H2

SMILES: c1cnc(cc1Cl)CCl

Synonyms:

• Pyridine, 4-Chloro-2-(Chloromethyl)-

Pyridine, 4-chloro-2-(chloromethyl)-

CAS: 10177-21-6

Formula: C₆H₅Cl₂N

Purity: 98%

Color and Shape: Liquid

Molecular weight: 162.0166

Ref: IN-DA0005G3

4-Chloro-2-(chloromethyl)pyridine

CAS: 10177-21-6

4-Chloro-2-(chloromethyl)pyridine

Purity: ≥95%

Molecular weight: 162.02g/mol

Ref: 54-OR76385

4-Chloro-2-(chloromethyl)pyridine

CAS: 10177-21-6

Purity: 97%

Molecular weight: 162.02

Ref: FT-C15545

4-CHLORO-2-(CHLOROMETHYL)PYRIDINE

CAS: 10177-21-6

Purity: 98%

Molecular weight: 162.0099945

Ref: 10-F826398

4-Chloro-2-(chloromethyl)pyridine

Controlled Product

CAS: 10177-21-6

Formula: C₆H₅Cl₂N

Color and Shape: Neat

Molecular weight: 656.634

Ref: TR-C367320

4-Chloro-2-(chloromethyl)pyridine

CAS: 10177-21-6

4-Chloro-2-(chloromethyl)pyridine is a heterocyclic compound with the chemical formula CHClN. It is a colorless liquid that is soluble in organic solvents and insoluble in water. 4-Chloro-2-(chloromethyl)pyridine is used as a precursor to picolinic acid, an intermediate for the synthesis of pharmaceuticals and other products. 4-Chloro-2-(chloromethyl)pyridine also serves as a catalyst for the synthesis of thionyl chloride and amide from pyridine nitrogen chloride. The use of this compound for various purposes has been detected by x-ray crystal structures, which are obtained through coordination chemistry techniques.

Formula: C₆H₅Cl₂N

Purity: Min. 95%

Molecular weight: 162.02 g/mol

Ref: 3D-KAA17721