CAS 10177-23-8
:Ethyl 6-(chloromethyl)-3-pyridinecarboxylate
Description:
Ethyl 6-(chloromethyl)-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylate functional group, which contributes to its reactivity and solubility in polar solvents. The presence of the chloromethyl group enhances its electrophilic character, making it a useful intermediate in various organic synthesis reactions. Ethyl 6-(chloromethyl)-3-pyridinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is moderately soluble in water and more soluble in organic solvents such as ethanol and acetone. The compound is of interest in medicinal chemistry and agrochemicals due to its potential biological activity and ability to serve as a building block for more complex molecules. Safety precautions should be taken when handling this substance, as it may pose health risks, including irritation to the skin and eyes, and should be stored in a cool, dry place away from incompatible materials.
Formula:C9H10ClNO2
InChI:InChI=1S/C9H10ClNO2/c1-2-13-9(12)7-3-4-8(5-10)11-6-7/h3-4,6H,2,5H2,1H3
InChI key:InChIKey=OMVMQZZXXLCHHI-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=CC(CCl)=NC1
Synonyms:- Ethyl 6-(chloromethyl)-3-pyridinecarboxylate
- Nicotinic acid, 6-(chloromethyl)-, ethyl ester
- Ethyl 6-(chloromethyl)nicotinate
- 3-Pyridinecarboxylic acid, 6-(chloromethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
