
CAS 10177-25-0
:2-Pyridinecarboxaldehyde, 5-chloro-, oxime
Description:
2-Pyridinecarboxaldehyde, 5-chloro-, oxime, also known by its CAS number 10177-25-0, is an organic compound characterized by the presence of a pyridine ring, a carboxaldehyde functional group, and an oxime group. This compound features a chlorine atom at the 5-position of the pyridine ring, which can influence its reactivity and physical properties. Typically, oximes are derived from aldehydes or ketones and are known for their ability to form stable complexes with metal ions, making them useful in various applications, including coordination chemistry. The presence of the oxime functional group can also impart specific reactivity, such as the ability to undergo rearrangements or participate in condensation reactions. In terms of physical properties, compounds of this nature may exhibit moderate solubility in polar solvents and can be sensitive to light and moisture. Overall, 2-Pyridinecarboxaldehyde, 5-chloro-, oxime is of interest in synthetic organic chemistry and may have potential applications in pharmaceuticals or agrochemicals.
Formula:C6H5ClN2O
InChI:InChI=1S/C6H5ClN2O/c7-5-1-2-6(4-9-10)8-3-5/h1-4,10H
InChI key:InChIKey=WODRWZMWFZSWQQ-UHFFFAOYSA-N
SMILES:C(=NO)C1=CC=C(Cl)C=N1
Synonyms:- 5-Chloropyridine-2-carboxaldehyde oxime
- Picolinaldehyde, 5-chloro-, oxime
- 2-Pyridinecarboxaldehyde, 5-chloro-, oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.