CAS 101772-33-2
:4-(Hexyloxy)benzamide
Description:
4-(Hexyloxy)benzamide, with the CAS number 101772-33-2, is an organic compound characterized by a benzamide structure substituted with a hexyloxy group at the para position. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including moderate solubility in organic solvents and potential hydrophobic characteristics due to the hexyloxy chain. The presence of the amide functional group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the hexyloxy substituent can enhance lipophilicity, which may affect its biological activity and potential applications in pharmaceuticals or materials science. The compound's stability, melting point, and boiling point can vary based on environmental conditions and purity. Overall, 4-(Hexyloxy)benzamide is of interest in various fields, including medicinal chemistry and organic synthesis, due to its unique structural features and potential functional properties.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15/h6-9H,2-5,10H2,1H3,(H2,14,15)
InChI key:InChIKey=NXOVDGSWSADBOP-UHFFFAOYSA-N
SMILES:O(CCCCCC)C1=CC=C(C(N)=O)C=C1
Synonyms:- 4-Hexyloxybenzamide
- Benzamide, p-(hexyloxy)-
- 4-N-HEXYLOXYBENZAMIDE
- Benzamide, 4-(hexyloxy)-
- 4-(Hexyloxy)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
