CymitQuimica logo

CAS 1017779-71-3

:

4,5-Difluoro-2-methoxyaniline

Description:
4,5-Difluoro-2-methoxyaniline is an organic compound characterized by the presence of two fluorine atoms and a methoxy group attached to an aniline structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and fluorine, reflecting its aromatic nature due to the aniline component. The fluorine substituents are located at the 4 and 5 positions of the aromatic ring, which can influence the compound's electronic properties and reactivity. The methoxy group, located at the 2 position, contributes to the compound's solubility and potential interactions in various chemical environments. This compound may exhibit unique characteristics such as altered boiling and melting points compared to its non-fluorinated counterparts, as well as distinct reactivity patterns in electrophilic aromatic substitution reactions. Additionally, the presence of fluorine can enhance the compound's stability and lipophilicity, making it of interest in pharmaceutical and agrochemical applications. Safety and handling precautions should be observed due to the potential toxicity associated with aniline derivatives.
Formula:C7H7F2NO
InChI:InChI=1/C7H7F2NO/c1-11-7-3-5(9)4(8)2-6(7)10/h2-3H,10H2,1H3
InChI key:InChIKey=JGCKFBTYRYSVJG-UHFFFAOYSA-N
SMILES:O(C)C1=C(N)C=C(F)C(F)=C1
Synonyms:
  • 4,5-Difluoro-2-methoxybenzenamine
  • Benzenamine, 4,5-difluoro-2-methoxy-
  • 4,5-Difluoro-2-methoxyaniline
  • (4,5-Difluoro-2-methoxyphenyl)amine
Found 5 products.