CAS 1017779-85-9

2-Ethoxy-3,5-difluorobenzeneacetic acid

Description:

2-Ethoxy-3,5-difluorobenzeneacetic acid is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms at the 3 and 5 positions and an ethoxy group at the 2 position. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit acidic properties. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its fluorine substituents can enhance its lipophilicity and influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The ethoxy group contributes to its solubility characteristics, potentially allowing for better interaction with organic solvents. Additionally, the compound's molecular structure suggests potential for hydrogen bonding due to the carboxylic acid group, which may affect its boiling point and melting point. Overall, 2-Ethoxy-3,5-difluorobenzeneacetic acid is a compound with unique properties that can be explored in various chemical contexts.

Formula: C₁₀H₁₀F₂O₃

InChI: InChI=1S/C10H10F2O3/c1-2-15-10-6(4-9(13)14)3-7(11)5-8(10)12/h3,5H,2,4H2,1H3,(H,13,14)

InChI key: InChIKey=NVCUEIFWLPGJTK-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1=C(OCC)C(F)=CC(F)=C1

Synonyms:

• 2-Ethoxy-3,5-difluorobenzeneacetic acid
• Benzeneacetic acid, 2-ethoxy-3,5-difluoro-
• 2-ETHOXY-3,5-DIFLUOROPHENYLACETIC ACID
• 2-(2-ethoxy-3,5-difluorophenyl)acetic acid

2-Ethoxy-3,5-difluorophenylacetic acid

CAS: 1017779-85-9

2-Ethoxy-3,5-difluorophenylacetic acid

Formula: C₁₀H₁₀F₂O₃

Purity: 98%

Color and Shape: clear/ off-white crystals

Molecular weight: 216.18g/mol

Ref: 54-PC302680