CAS 1017781-34-8
:3-(4-Iodophenyl)-1-phenyl-1H-pyrazol-5-amine
Description:
3-(4-Iodophenyl)-1-phenyl-1H-pyrazol-5-amine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a phenyl group and a 4-iodophenyl substituent enhances its aromatic character, contributing to its potential applications in medicinal chemistry and material science. This compound typically exhibits moderate to high lipophilicity due to its aromatic structures, which can influence its solubility and bioavailability. The iodine atom introduces a halogen, which can enhance the compound's reactivity and may facilitate interactions with biological targets. Additionally, the amine functional group can participate in hydrogen bonding, making it a potential candidate for various chemical reactions, including coupling reactions and as a ligand in coordination chemistry. Its unique structural features may also impart specific biological activities, making it of interest in drug discovery and development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H12IN3
InChI:InChI=1S/C15H12IN3/c16-12-8-6-11(7-9-12)14-10-15(17)19(18-14)13-4-2-1-3-5-13/h1-10H,17H2
InChI key:InChIKey=FLXQDKZROUTIQQ-UHFFFAOYSA-N
SMILES:NC1=CC(=NN1C2=CC=CC=C2)C3=CC=C(I)C=C3
Synonyms:- 3-(4-Iodophenyl)-1-phenyl-1H-pyrazol-5-amine
- 1H-Pyrazol-5-amine, 3-(4-iodophenyl)-1-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
