CymitQuimica logo

CAS 1017781-35-9

:

3-(3-Iodophenyl)-1-phenyl-1H-pyrazol-5-amine

Description:
3-(3-Iodophenyl)-1-phenyl-1H-pyrazol-5-amine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group and a 3-iodophenyl substituent, contributing to its unique chemical properties. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The amine functional group at the 5-position of the pyrazole ring allows for potential interactions in biological systems, such as hydrogen bonding. This compound may exhibit various physical properties, including solubility in organic solvents, and its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Additionally, the presence of halogen atoms like iodine can affect the compound's electronic properties, stability, and overall reactivity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H12IN3
InChI:InChI=1S/C15H12IN3/c16-12-6-4-5-11(9-12)14-10-15(17)19(18-14)13-7-2-1-3-8-13/h1-10H,17H2
InChI key:InChIKey=BGBSKFFBYFTNEZ-UHFFFAOYSA-N
SMILES:NC1=CC(=NN1C2=CC=CC=C2)C3=CC(I)=CC=C3
Synonyms:
  • 1H-Pyrazol-5-amine, 3-(3-iodophenyl)-1-phenyl-
  • 3-(3-Iodophenyl)-1-phenyl-1H-pyrazol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.